C14H15N3O — CID 113366545
2-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyridin-4-amine (PubChem CID 113366545) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyridin-4-amine.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 113366545 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzoxazepin-5-yl)pyridin-4-amine |
| SMILES | Nc1ccnc(N2CCCOc3ccccc32)c1 |
| InChI | InChI=1S/C14H15N3O/c15-11-6-7-16-14(10-11)17-8-3-9-18-13-5-2-1-4-12(13)17/h1-2,4-7,10H,3,8-9H2,(H2,15,16) |
| InChIKey | PVMLAFDRRYFIDK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |