C14H21F3N2O4 — CID 11336668
ethyl (2S)-2-[(4S)-2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]-3,3,3-trifluoropropanoate (PubChem CID 11336668) has the molecular formula C14H21F3N2O4 and a molecular weight of 338.33 g/mol. Its IUPAC name is ethyl (2S)-2-[(4S)-2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-[(4S)-2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 11336668 |
| Molecular Formula | C14H21F3N2O4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl (2S)-2-[(4S)-2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@H]([C@H]1C(=O)N(C(C)C)C(=O)N1C(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O4/c1-6-23-12(21)9(14(15,16)17)10-11(20)19(8(4)5)13(22)18(10)7(2)3/h7-10H,6H2,1-5H3/t9-,10-/m0/s1 |
| InChIKey | HWDIDEIWWNFNNZ-UWVGGRQHSA-N |
| XLogP | 2.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|