About 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine
6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 11336672) has the molecular formula C21H14N4O
and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine.
Molecular Properties
| Compound Name | 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine |
| PubChem CID | 11336672 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | c1ccc(Oc2nn3c(-c4ccccc4)nnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C21H14N4O/c1-3-9-15(10-4-1)19-22-23-20-17-13-7-8-14-18(17)21(24-25(19)20)26-16-11-5-2-6-12-16/h1-14H |
| InChIKey | UXZWCMZNERUUGD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine?
The IUPAC name of 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine (CID 11336672) is 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine.
What is the SMILES notation for 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine?
The canonical SMILES for 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine is c1ccc(Oc2nn3c(-c4ccccc4)nnc3c3ccccc23)cc1.
What is the InChIKey of 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine?
The InChIKey is UXZWCMZNERUUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N4O/c1-3-9-15(10-4-1)19-22-23-20-17-13-7-8-14-18(17)21(24-25(19)20)26-16-11-5-2-6-12-16/h1-14H.
What are the key properties of 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine?
6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine has a molecular weight of 338.37 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenoxy-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazine is sourced from PubChem (CID 11336672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).