About 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one
7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one (PubChem CID 11336752) has the molecular formula C19H20N2O2S
and a molecular weight of 340.45 g/mol. Its IUPAC name is 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one.
Molecular Properties
| Compound Name | 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one |
| PubChem CID | 11336752 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1ncc(-c2nccs2)o1 |
| InChI | InChI=1S/C19H20N2O2S/c22-16(18-21-14-17(23-18)19-20-12-13-24-19)11-7-2-1-4-8-15-9-5-3-6-10-15/h3,5-6,9-10,12-14H,1-2,4,7-8,11H2 |
| InChIKey | IGPZWQIXJWXRCL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one?
The IUPAC name of 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one (CID 11336752) is 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one.
What is the SMILES notation for 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one?
The canonical SMILES for 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one is O=C(CCCCCCc1ccccc1)c1ncc(-c2nccs2)o1.
What is the InChIKey of 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one?
The InChIKey is IGPZWQIXJWXRCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2S/c22-16(18-21-14-17(23-18)19-20-12-13-24-19)11-7-2-1-4-8-15-9-5-3-6-10-15/h3,5-6,9-10,12-14H,1-2,4,7-8,11H2.
What are the key properties of 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one?
7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one has a molecular weight of 340.45 g/mol, XLogP of 5.17, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-1-[5-(1,3-thiazol-2-yl)-1,3-oxazol-2-yl]heptan-1-one is sourced from PubChem (CID 11336752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).