C20H40O2Si — CID 11336762
[(2R,4S)-3,3-dimethyl-2-(2-methylpropyl)-2,4-dihydropyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11336762) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is [(2R,4S)-3,3-dimethyl-2-(2-methylpropyl)-2,4-dihydropyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,4S)-3,3-dimethyl-2-(2-methylpropyl)-2,4-dihydropyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11336762 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | [(2R,4S)-3,3-dimethyl-2-(2-methylpropyl)-2,4-dihydropyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)C[C@H]1OC=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C1(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-14(2)13-19-20(9,10)18(11-12-21-19)22-23(15(3)4,16(5)6)17(7)8/h11-12,14-19H,13H2,1-10H3/t18-,19+/m0/s1 |
| InChIKey | CMHXAEOEKOEBAW-RBUKOAKNSA-N |
| XLogP | 6.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|