C14H22N4 — CID 113367655
2-N-ethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)pyridine-2,4-diamine (PubChem CID 113367655) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-N-ethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)pyridine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 113367655 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-N-ethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)pyridine-2,4-diamine |
| SMILES | CCNc1cc(NC2CCN3CCCC23)ccn1 |
| InChI | InChI=1S/C14H22N4/c1-2-15-14-10-11(5-7-16-14)17-12-6-9-18-8-3-4-13(12)18/h5,7,10,12-13H,2-4,6,8-9H2,1H3,(H2,15,16,17) |
| InChIKey | FJHUJSBUQZBBSO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |