C17H18Cl2O3 — CID 11336770
1,3-bis[2-(chloromethyl)phenoxy]propan-2-ol (PubChem CID 11336770) has the molecular formula C17H18Cl2O3 and a molecular weight of 341.23 g/mol. Its IUPAC name is 1,3-bis[2-(chloromethyl)phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[2-(chloromethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 11336770 |
| Molecular Formula | C17H18Cl2O3 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1,3-bis[2-(chloromethyl)phenoxy]propan-2-ol |
| SMILES | OC(COc1ccccc1CCl)COc1ccccc1CCl |
| InChI | InChI=1S/C17H18Cl2O3/c18-9-13-5-1-3-7-16(13)21-11-15(20)12-22-17-8-4-2-6-14(17)10-19/h1-8,15,20H,9-12H2 |
| InChIKey | IHJBADKKLTUCLY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|