About 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine
5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine (PubChem CID 113368832) has the molecular formula C10H16ClN3O3
and a molecular weight of 261.71 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine |
| PubChem CID | 113368832 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine |
| SMILES | COCC(CNc1nc(OC)ncc1Cl)OC |
| InChI | InChI=1S/C10H16ClN3O3/c1-15-6-7(16-2)4-12-9-8(11)5-13-10(14-9)17-3/h5,7H,4,6H2,1-3H3,(H,12,13,14) |
| InChIKey | AZWROYOXKKPFBU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine?
The IUPAC name of 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine (CID 113368832) is 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine.
What is the SMILES notation for 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine?
The canonical SMILES for 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine is COCC(CNc1nc(OC)ncc1Cl)OC.
What is the InChIKey of 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine?
The InChIKey is AZWROYOXKKPFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O3/c1-15-6-7(16-2)4-12-9-8(11)5-13-10(14-9)17-3/h5,7H,4,6H2,1-3H3,(H,12,13,14).
What are the key properties of 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine?
5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine has a molecular weight of 261.71 g/mol, XLogP of 1.21, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(2,3-dimethoxypropyl)-2-methoxypyrimidin-4-amine is sourced from PubChem (CID 113368832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).