C11H20F3NO2 — CID 113369122
3-(2,6-dimethyloxan-4-yl)oxy-4,4,4-trifluorobutan-1-amine (PubChem CID 113369122) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-(2,6-dimethyloxan-4-yl)oxy-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(2,6-dimethyloxan-4-yl)oxy-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 113369122 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-(2,6-dimethyloxan-4-yl)oxy-4,4,4-trifluorobutan-1-amine |
| SMILES | CC1CC(OC(CCN)C(F)(F)F)CC(C)O1 |
| InChI | InChI=1S/C11H20F3NO2/c1-7-5-9(6-8(2)16-7)17-10(3-4-15)11(12,13)14/h7-10H,3-6,15H2,1-2H3 |
| InChIKey | BJRIUEGBCNTAHP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |