C15H11ClFN5S — CID 11336972
4-(3-chloro-4-fluorophenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 11336972) has the molecular formula C15H11ClFN5S and a molecular weight of 347.81 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 11336972 |
| Molecular Formula | C15H11ClFN5S |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(-c3ccc(F)c(Cl)c3)nc2c2c1ncn2C |
| InChI | InChI=1S/C15H11ClFN5S/c1-18-13-10-12(22(2)6-19-10)11-15(21-13)23-14(20-11)7-3-4-9(17)8(16)5-7/h3-6H,1-2H3,(H,18,21) |
| InChIKey | LAJVGPMNRZFRLC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |