C17H22ClN3OS — CID 11337097
3-[(2-chlorophenyl)-hydroxymethyl]-4-cyclooctyl-1H-1,2,4-triazole-5-thione (PubChem CID 11337097) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-hydroxymethyl]-4-cyclooctyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-cyclooctyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11337097 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-cyclooctyl-1H-1,2,4-triazole-5-thione |
| SMILES | OC(c1ccccc1Cl)c1n[nH]c(=S)n1C1CCCCCCC1 |
| InChI | InChI=1S/C17H22ClN3OS/c18-14-11-7-6-10-13(14)15(22)16-19-20-17(23)21(16)12-8-4-2-1-3-5-9-12/h6-7,10-12,15,22H,1-5,8-9H2,(H,20,23) |
| InChIKey | MAZCWWLDDYYJJE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|