C13H20N2O2 — CID 113371010
[1-[[(3-methoxy-2-pyridinyl)amino]methyl]cyclopentyl]methanol (PubChem CID 113371010) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-[[(3-methoxy-2-pyridinyl)amino]methyl]cyclopentyl]methanol.
| Compound Name | [1-[[(3-methoxy-2-pyridinyl)amino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 113371010 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [1-[[(3-methoxy-2-pyridinyl)amino]methyl]cyclopentyl]methanol |
| SMILES | COc1cccnc1NCC1(CO)CCCC1 |
| InChI | InChI=1S/C13H20N2O2/c1-17-11-5-4-8-14-12(11)15-9-13(10-16)6-2-3-7-13/h4-5,8,16H,2-3,6-7,9-10H2,1H3,(H,14,15) |
| InChIKey | NFACDEZFPJBRDV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |