C18H17F3O4 — CID 11337171
[(2S,3S)-4,4,4-trifluoro-3-hydroxy-1-phenylmethoxybutan-2-yl] benzoate (PubChem CID 11337171) has the molecular formula C18H17F3O4 and a molecular weight of 354.32 g/mol. Its IUPAC name is [(2S,3S)-4,4,4-trifluoro-3-hydroxy-1-phenylmethoxybutan-2-yl] benzoate.
| Compound Name | [(2S,3S)-4,4,4-trifluoro-3-hydroxy-1-phenylmethoxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 11337171 |
| Molecular Formula | C18H17F3O4 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(2S,3S)-4,4,4-trifluoro-3-hydroxy-1-phenylmethoxybutan-2-yl] benzoate |
| SMILES | O=C(O[C@@H](COCc1ccccc1)[C@H](O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H17F3O4/c19-18(20,21)16(22)15(12-24-11-13-7-3-1-4-8-13)25-17(23)14-9-5-2-6-10-14/h1-10,15-16,22H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | QJDDXXVNIZAKCI-HOTGVXAUSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |