C18H32O5Si — CID 11337237
dimethyl 2-[(3S,4E)-7-[tert-butyl(dimethyl)silyl]oxyhepta-1,4-dien-3-yl]propanedioate (PubChem CID 11337237) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is dimethyl 2-[(3S,4E)-7-[tert-butyl(dimethyl)silyl]oxyhepta-1,4-dien-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(3S,4E)-7-[tert-butyl(dimethyl)silyl]oxyhepta-1,4-dien-3-yl]propanedioate |
|---|---|
| PubChem CID | 11337237 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | dimethyl 2-[(3S,4E)-7-[tert-butyl(dimethyl)silyl]oxyhepta-1,4-dien-3-yl]propanedioate |
| SMILES | C=C[C@@H](/C=C/CCO[Si](C)(C)C(C)(C)C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H32O5Si/c1-9-14(15(16(19)21-5)17(20)22-6)12-10-11-13-23-24(7,8)18(2,3)4/h9-10,12,14-15H,1,11,13H2,2-8H3/b12-10+/t14-/m0/s1 |
| InChIKey | JDVXQIMIEJHPJJ-WONIAPNHSA-N |
| XLogP | 3.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|