About 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde
5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde (PubChem CID 113372417) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde |
| PubChem CID | 113372417 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde |
| SMILES | Cc1nc(SCc2ccc(C=O)o2)nc(C)c1C |
| InChI | InChI=1S/C13H14N2O2S/c1-8-9(2)14-13(15-10(8)3)18-7-12-5-4-11(6-16)17-12/h4-6H,7H2,1-3H3 |
| InChIKey | XSUQYMWWZNDVFB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde?
The IUPAC name of 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde (CID 113372417) is 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde is Cc1nc(SCc2ccc(C=O)o2)nc(C)c1C.
What is the InChIKey of 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde?
The InChIKey is XSUQYMWWZNDVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c1-8-9(2)14-13(15-10(8)3)18-7-12-5-4-11(6-16)17-12/h4-6H,7H2,1-3H3.
What are the key properties of 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde?
5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde has a molecular weight of 262.33 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,5,6-trimethylpyrimidin-2-yl)sulfanylmethyl]furan-2-carbaldehyde is sourced from PubChem (CID 113372417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).