C14H21NO2S — CID 113373079
1-oxaspiro[5.5]undecan-4-yl(1,3-thiazol-2-yl)methanol (PubChem CID 113373079) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-oxaspiro[5.5]undecan-4-yl(1,3-thiazol-2-yl)methanol.
| Compound Name | 1-oxaspiro[5.5]undecan-4-yl(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 113373079 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-oxaspiro[5.5]undecan-4-yl(1,3-thiazol-2-yl)methanol |
| SMILES | OC(c1nccs1)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C14H21NO2S/c16-12(13-15-7-9-18-13)11-4-8-17-14(10-11)5-2-1-3-6-14/h7,9,11-12,16H,1-6,8,10H2 |
| InChIKey | ZITBIENJTHRRCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |