C14H17ClN2OS — CID 113373734
5-(chloromethyl)-2-[(2-methoxy-5-methylphenyl)methylsulfanyl]-1-methylimidazole (PubChem CID 113373734) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 5-(chloromethyl)-2-[(2-methoxy-5-methylphenyl)methylsulfanyl]-1-methylimidazole.
| Compound Name | 5-(chloromethyl)-2-[(2-methoxy-5-methylphenyl)methylsulfanyl]-1-methylimidazole |
|---|---|
| PubChem CID | 113373734 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(chloromethyl)-2-[(2-methoxy-5-methylphenyl)methylsulfanyl]-1-methylimidazole |
| SMILES | COc1ccc(C)cc1CSc1ncc(CCl)n1C |
| InChI | InChI=1S/C14H17ClN2OS/c1-10-4-5-13(18-3)11(6-10)9-19-14-16-8-12(7-15)17(14)2/h4-6,8H,7,9H2,1-3H3 |
| InChIKey | YUSHHIDPLWJZSL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|