C14H22BrNOS — CID 113373840
2-[2-bromo-4-[1-(propylamino)ethyl]phenyl]sulfanylpropan-1-ol (PubChem CID 113373840) has the molecular formula C14H22BrNOS and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-[2-bromo-4-[1-(propylamino)ethyl]phenyl]sulfanylpropan-1-ol.
| Compound Name | 2-[2-bromo-4-[1-(propylamino)ethyl]phenyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 113373840 |
| Molecular Formula | C14H22BrNOS |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[2-bromo-4-[1-(propylamino)ethyl]phenyl]sulfanylpropan-1-ol |
| SMILES | CCCNC(C)c1ccc(SC(C)CO)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNOS/c1-4-7-16-11(3)12-5-6-14(13(15)8-12)18-10(2)9-17/h5-6,8,10-11,16-17H,4,7,9H2,1-3H3 |
| InChIKey | AENZIWASPUXUJH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |