C10H10N2O3S2 — CID 113373853
2-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol (PubChem CID 113373853) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol.
| Compound Name | 2-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 113373853 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
| SMILES | CC(CO)Sc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O3S2/c1-6(4-13)17-8-3-2-7-9(11-5-16-7)10(8)12(14)15/h2-3,5-6,13H,4H2,1H3 |
| InChIKey | CNODAUZKFVNHBH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|