About 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol
5-(2,4,6-triethylphenyl)pent-4-yn-1-ol (PubChem CID 113374407) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol.
Molecular Properties
| Compound Name | 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol |
| PubChem CID | 113374407 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol |
| SMILES | CCc1cc(CC)c(C#CCCCO)c(CC)c1 |
| InChI | InChI=1S/C17H24O/c1-4-14-12-15(5-2)17(16(6-3)13-14)10-8-7-9-11-18/h12-13,18H,4-7,9,11H2,1-3H3 |
| InChIKey | SWUYUVJSJUZRIC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol?
The IUPAC name of 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol (CID 113374407) is 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol.
What is the SMILES notation for 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol?
The canonical SMILES for 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol is CCc1cc(CC)c(C#CCCCO)c(CC)c1.
What is the InChIKey of 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol?
The InChIKey is SWUYUVJSJUZRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-4-14-12-15(5-2)17(16(6-3)13-14)10-8-7-9-11-18/h12-13,18H,4-7,9,11H2,1-3H3.
What are the key properties of 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol?
5-(2,4,6-triethylphenyl)pent-4-yn-1-ol has a molecular weight of 244.38 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4,6-triethylphenyl)pent-4-yn-1-ol is sourced from PubChem (CID 113374407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).