C21H38O3Si — CID 11337565
methyl (E,4R,7S,9R)-5,7,9-trimethyl-4-triethylsilyloxyundec-5-en-2-ynoate (PubChem CID 11337565) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is methyl (E,4R,7S,9R)-5,7,9-trimethyl-4-triethylsilyloxyundec-5-en-2-ynoate.
| Compound Name | methyl (E,4R,7S,9R)-5,7,9-trimethyl-4-triethylsilyloxyundec-5-en-2-ynoate |
|---|---|
| PubChem CID | 11337565 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | methyl (E,4R,7S,9R)-5,7,9-trimethyl-4-triethylsilyloxyundec-5-en-2-ynoate |
| SMILES | CC[C@@H](C)C[C@H](C)/C=C(\C)[C@H](C#CC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38O3Si/c1-9-17(5)15-18(6)16-19(7)20(13-14-21(22)23-8)24-25(10-2,11-3)12-4/h16-18,20H,9-12,15H2,1-8H3/b19-16+/t17-,18+,20+/m1/s1 |
| InChIKey | UTJRCKCBRJNOSG-NLOMAMABSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|