C14H20ClNO — CID 113376014
4-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentan-2-ol (PubChem CID 113376014) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 4-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentan-2-ol.
| Compound Name | 4-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 113376014 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentan-2-ol |
| SMILES | CC(O)CC(C)NC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C14H20ClNO/c1-9(5-10(2)17)16-14-7-11-3-4-13(15)6-12(11)8-14/h3-4,6,9-10,14,16-17H,5,7-8H2,1-2H3 |
| InChIKey | JAHNXWRZNPFRTI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |