About [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate
[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate (PubChem CID 11337701) has the molecular formula C16H12F3NO4S
and a molecular weight of 371.34 g/mol. Its IUPAC name is [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 11337701 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=C1Nc2ccccc2CC1c1cccc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F3NO4S/c17-16(18,19)25(22,23)24-12-6-3-5-10(8-12)13-9-11-4-1-2-7-14(11)20-15(13)21/h1-8,13H,9H2,(H,20,21) |
| InChIKey | WNCFASJYFDEEOQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate (CID 11337701) is [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate is O=C1Nc2ccccc2CC1c1cccc(OS(=O)(=O)C(F)(F)F)c1.
What is the InChIKey of [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is WNCFASJYFDEEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F3NO4S/c17-16(18,19)25(22,23)24-12-6-3-5-10(8-12)13-9-11-4-1-2-7-14(11)20-15(13)21/h1-8,13H,9H2,(H,20,21).
What are the key properties of [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate?
[3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 371.34 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-oxo-3,4-dihydro-1H-quinolin-3-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 11337701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).