C12H18N2O4 — CID 113377140
ethyl 2-(3-ethylmorpholin-4-yl)-1,3-oxazole-4-carboxylate (PubChem CID 113377140) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl 2-(3-ethylmorpholin-4-yl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(3-ethylmorpholin-4-yl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113377140 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl 2-(3-ethylmorpholin-4-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(N2CCOCC2CC)n1 |
| InChI | InChI=1S/C12H18N2O4/c1-3-9-7-16-6-5-14(9)12-13-10(8-18-12)11(15)17-4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | FCFDZCAHFDXBIO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |