About 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid
2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid (PubChem CID 113377319) has the molecular formula C13H19N3O3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 113377319 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid |
| SMILES | CN1C2CCCC1CC(Nc1nc(C(=O)O)co1)C2 |
| InChI | InChI=1S/C13H19N3O3/c1-16-9-3-2-4-10(16)6-8(5-9)14-13-15-11(7-19-13)12(17)18/h7-10H,2-6H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | IWUWVEAOWDFGSK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid (CID 113377319) is 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid is CN1C2CCCC1CC(Nc1nc(C(=O)O)co1)C2.
What is the InChIKey of 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid?
The InChIKey is IWUWVEAOWDFGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3/c1-16-9-3-2-4-10(16)6-8(5-9)14-13-15-11(7-19-13)12(17)18/h7-10H,2-6H2,1H3,(H,14,15)(H,17,18).
What are the key properties of 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid?
2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid has a molecular weight of 265.31 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)amino]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 113377319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).