About 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine
4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine (PubChem CID 113377666) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine |
| PubChem CID | 113377666 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine |
| SMILES | CCNCc1coc(N(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C14H27N3O/c1-6-15-7-13-10-18-14(16-13)17(8-11(2)3)9-12(4)5/h10-12,15H,6-9H2,1-5H3 |
| InChIKey | GKDOSWGWIRPJHO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine?
The IUPAC name of 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine (CID 113377666) is 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine.
What is the SMILES notation for 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine?
The canonical SMILES for 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine is CCNCc1coc(N(CC(C)C)CC(C)C)n1.
What is the InChIKey of 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine?
The InChIKey is GKDOSWGWIRPJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-6-15-7-13-10-18-14(16-13)17(8-11(2)3)9-12(4)5/h10-12,15H,6-9H2,1-5H3.
What are the key properties of 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine?
4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine has a molecular weight of 253.39 g/mol, XLogP of 2.90, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylaminomethyl)-N,N-bis(2-methylpropyl)-1,3-oxazol-2-amine is sourced from PubChem (CID 113377666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).