C13H16N2O3 — CID 113377974
[2-(2-propoxyphenoxy)-1,3-oxazol-4-yl]methanamine (PubChem CID 113377974) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [2-(2-propoxyphenoxy)-1,3-oxazol-4-yl]methanamine.
| Compound Name | [2-(2-propoxyphenoxy)-1,3-oxazol-4-yl]methanamine |
|---|---|
| PubChem CID | 113377974 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [2-(2-propoxyphenoxy)-1,3-oxazol-4-yl]methanamine |
| SMILES | CCCOc1ccccc1Oc1nc(CN)co1 |
| InChI | InChI=1S/C13H16N2O3/c1-2-7-16-11-5-3-4-6-12(11)18-13-15-10(8-14)9-17-13/h3-6,9H,2,7-8,14H2,1H3 |
| InChIKey | LTBKLCQKPDZTDU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |