C24H30N2O2 — CID 11337925
N,N-diethyl-4-spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ylbenzamide (PubChem CID 11337925) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N,N-diethyl-4-spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ylbenzamide.
| Compound Name | N,N-diethyl-4-spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ylbenzamide |
|---|---|
| PubChem CID | 11337925 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N,N-diethyl-4-spiro[3,4-dihydrochromene-2,4'-piperidine]-4-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C2CC3(CCNCC3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-26(4-2)23(27)19-11-9-18(10-12-19)21-17-24(13-15-25-16-14-24)28-22-8-6-5-7-20(21)22/h5-12,21,25H,3-4,13-17H2,1-2H3 |
| InChIKey | YHEWTLLIVPRLRS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |