C23H42O2Si — CID 11337931
(4R,6R)-2,5,5-trimethyl-6-[3-tri(propan-2-yl)silylprop-2-ynoxy]oct-7-yn-4-ol (PubChem CID 11337931) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (4R,6R)-2,5,5-trimethyl-6-[3-tri(propan-2-yl)silylprop-2-ynoxy]oct-7-yn-4-ol.
| Compound Name | (4R,6R)-2,5,5-trimethyl-6-[3-tri(propan-2-yl)silylprop-2-ynoxy]oct-7-yn-4-ol |
|---|---|
| PubChem CID | 11337931 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (4R,6R)-2,5,5-trimethyl-6-[3-tri(propan-2-yl)silylprop-2-ynoxy]oct-7-yn-4-ol |
| SMILES | C#C[C@@H](OCC#C[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)[C@H](O)CC(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-12-22(23(10,11)21(24)16-17(2)3)25-14-13-15-26(18(4)5,19(6)7)20(8)9/h1,17-22,24H,14,16H2,2-11H3/t21-,22-/m1/s1 |
| InChIKey | HCLKCCXEZRQFCM-FGZHOGPDSA-N |
| XLogP | 5.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|