C21H20N2O5 — CID 11337978
(2R,3S)-1-(9,10-dihydrophenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid (PubChem CID 11337978) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2R,3S)-1-(9,10-dihydrophenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid.
| Compound Name | (2R,3S)-1-(9,10-dihydrophenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11337978 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2R,3S)-1-(9,10-dihydrophenanthrene-2-carbonyl)piperazine-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1NCCN(C(=O)c2ccc3c(c2)CCc2ccccc2-3)[C@H]1C(=O)O |
| InChI | InChI=1S/C21H20N2O5/c24-19(23-10-9-22-17(20(25)26)18(23)21(27)28)14-7-8-16-13(11-14)6-5-12-3-1-2-4-15(12)16/h1-4,7-8,11,17-18,22H,5-6,9-10H2,(H,25,26)(H,27,28)/t17-,18+/m0/s1 |
| InChIKey | PJJUPJRHTRONSU-ZWKOTPCHSA-N |
| XLogP | 1.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |