C20H26ClN3O — CID 113379794
N-benzyl-2-chloro-N-[2-(dimethylamino)ethyl]-6-propylpyridine-4-carboxamide (PubChem CID 113379794) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[2-(dimethylamino)ethyl]-6-propylpyridine-4-carboxamide.
| Compound Name | N-benzyl-2-chloro-N-[2-(dimethylamino)ethyl]-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 113379794 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-benzyl-2-chloro-N-[2-(dimethylamino)ethyl]-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)N(CCN(C)C)Cc2ccccc2)cc(Cl)n1 |
| InChI | InChI=1S/C20H26ClN3O/c1-4-8-18-13-17(14-19(21)22-18)20(25)24(12-11-23(2)3)15-16-9-6-5-7-10-16/h5-7,9-10,13-14H,4,8,11-12,15H2,1-3H3 |
| InChIKey | IMVLWGLMNCKOGZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|