C15H22N2O2 — CID 113380095
2-[ethyl(2-methylprop-2-enyl)amino]-6-propylpyridine-4-carboxylic acid (PubChem CID 113380095) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[ethyl(2-methylprop-2-enyl)amino]-6-propylpyridine-4-carboxylic acid.
| Compound Name | 2-[ethyl(2-methylprop-2-enyl)amino]-6-propylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 113380095 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[ethyl(2-methylprop-2-enyl)amino]-6-propylpyridine-4-carboxylic acid |
| SMILES | C=C(C)CN(CC)c1cc(C(=O)O)cc(CCC)n1 |
| InChI | InChI=1S/C15H22N2O2/c1-5-7-13-8-12(15(18)19)9-14(16-13)17(6-2)10-11(3)4/h8-9H,3,5-7,10H2,1-2,4H3,(H,18,19) |
| InChIKey | AWFYDLCDBJUAFW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|