C18H28N2O7 — CID 11338086
5-[(3aS,4S,6R,6aR)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dimethoxypyrimidine (PubChem CID 11338086) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-[(3aS,4S,6R,6aR)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dimethoxypyrimidine.
| Compound Name | 5-[(3aS,4S,6R,6aR)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dimethoxypyrimidine |
|---|---|
| PubChem CID | 11338086 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 5-[(3aS,4S,6R,6aR)-6-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc([C@@H]2O[C@H](COC(C)(C)OC)[C@H]3OC(C)(C)O[C@H]32)c(OC)n1 |
| InChI | InChI=1S/C18H28N2O7/c1-17(2,23-7)24-9-11-13-14(27-18(3,4)26-13)12(25-11)10-8-19-16(22-6)20-15(10)21-5/h8,11-14H,9H2,1-7H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | WHWYOZNLNBJBLK-RQJABVFESA-N |
| XLogP | 1.85 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|