C23H32N2O3 — CID 11338104
pentyl 4-(1-adamantylcarbamoylamino)benzoate (PubChem CID 11338104) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is pentyl 4-(1-adamantylcarbamoylamino)benzoate.
| Compound Name | pentyl 4-(1-adamantylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 11338104 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | pentyl 4-(1-adamantylcarbamoylamino)benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-2-3-4-9-28-21(26)19-5-7-20(8-6-19)24-22(27)25-23-13-16-10-17(14-23)12-18(11-16)15-23/h5-8,16-18H,2-4,9-15H2,1H3,(H2,24,25,27) |
| InChIKey | WXVGAPMYBKZGGZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|