C12H10FNO3S — CID 113382313
3-[2-(3-fluorophenyl)-2-oxoethyl]-1,3-thiazinane-2,4-dione (PubChem CID 113382313) has the molecular formula C12H10FNO3S and a molecular weight of 267.28 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)-2-oxoethyl]-1,3-thiazinane-2,4-dione.
| Compound Name | 3-[2-(3-fluorophenyl)-2-oxoethyl]-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 113382313 |
| Molecular Formula | C12H10FNO3S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-[2-(3-fluorophenyl)-2-oxoethyl]-1,3-thiazinane-2,4-dione |
| SMILES | O=C(CN1C(=O)CCSC1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H10FNO3S/c13-9-3-1-2-8(6-9)10(15)7-14-11(16)4-5-18-12(14)17/h1-3,6H,4-5,7H2 |
| InChIKey | XFEBQFOPEIKGQJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|