C20H25NO7 — CID 11338310
ethyl (2R,3aS,7S)-2-(3-ethoxy-3-oxopropyl)-4-oxo-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2-carboxylate (PubChem CID 11338310) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is ethyl (2R,3aS,7S)-2-(3-ethoxy-3-oxopropyl)-4-oxo-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2-carboxylate.
| Compound Name | ethyl (2R,3aS,7S)-2-(3-ethoxy-3-oxopropyl)-4-oxo-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2-carboxylate |
|---|---|
| PubChem CID | 11338310 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | ethyl (2R,3aS,7S)-2-(3-ethoxy-3-oxopropyl)-4-oxo-7-phenyl-3,3a,6,7-tetrahydro-[1,2]oxazolo[3,2-c][1,4]oxazine-2-carboxylate |
| SMILES | CCOC(=O)CC[C@]1(C(=O)OCC)C[C@H]2C(=O)OC[C@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C20H25NO7/c1-3-25-17(22)10-11-20(19(24)26-4-2)12-15-18(23)27-13-16(21(15)28-20)14-8-6-5-7-9-14/h5-9,15-16H,3-4,10-13H2,1-2H3/t15-,16+,20+/m0/s1 |
| InChIKey | UXGASMYEIDKREJ-RZQQEMMASA-N |
| XLogP | 1.94 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|