C8H6F2N4O2S2 — CID 113383113
5-amino-N-(2,5-difluorophenyl)-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 113383113) has the molecular formula C8H6F2N4O2S2 and a molecular weight of 292.29 g/mol. Its IUPAC name is 5-amino-N-(2,5-difluorophenyl)-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-amino-N-(2,5-difluorophenyl)-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 113383113 |
| Molecular Formula | C8H6F2N4O2S2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 5-amino-N-(2,5-difluorophenyl)-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Nc1nnc(S(=O)(=O)Nc2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C8H6F2N4O2S2/c9-4-1-2-5(10)6(3-4)14-18(15,16)8-13-12-7(11)17-8/h1-3,14H,(H2,11,12) |
| InChIKey | AGJRLQRDOQLJKI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |