C15H22N2O — CID 113383435
1-(2-bicyclo[2.2.1]heptanyl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanone (PubChem CID 113383435) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanone.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 113383435 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3-ethyl-1-methylpyrazol-5-yl)ethanone |
| SMILES | CCc1cc(CC(=O)C2CC3CCC2C3)n(C)n1 |
| InChI | InChI=1S/C15H22N2O/c1-3-12-8-13(17(2)16-12)9-15(18)14-7-10-4-5-11(14)6-10/h8,10-11,14H,3-7,9H2,1-2H3 |
| InChIKey | JTMNFHIDORGTKW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |