C16H16N4O4S2 — CID 11338346
1,4-bis[(E)-2-(5-nitrothiophen-2-yl)ethenyl]piperazine (PubChem CID 11338346) has the molecular formula C16H16N4O4S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(5-nitrothiophen-2-yl)ethenyl]piperazine.
| Compound Name | 1,4-bis[(E)-2-(5-nitrothiophen-2-yl)ethenyl]piperazine |
|---|---|
| PubChem CID | 11338346 |
| Molecular Formula | C16H16N4O4S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1,4-bis[(E)-2-(5-nitrothiophen-2-yl)ethenyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(/C=C/N2CCN(/C=C/c3ccc([N+](=O)[O-])s3)CC2)s1 |
| InChI | InChI=1S/C16H16N4O4S2/c21-19(22)15-3-1-13(25-15)5-7-17-9-11-18(12-10-17)8-6-14-2-4-16(26-14)20(23)24/h1-8H,9-12H2/b7-5+,8-6+ |
| InChIKey | IWYGLFRAZYSTNR-KQQUZDAGSA-N |
| XLogP | 3.89 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|