C24H40O4 — CID 11338352
2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-2-methylicosa-5,8,11,14-tetraenoate (PubChem CID 11338352) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-2-methylicosa-5,8,11,14-tetraenoate.
| Compound Name | 2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-2-methylicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 11338352 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 2,3-dihydroxypropyl (5Z,8Z,11Z,14Z)-2-methylicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)C(=O)OCC(O)CO |
| InChI | InChI=1S/C24H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)24(27)28-21-23(26)20-25/h7-8,10-11,13-14,16-17,22-23,25-26H,3-6,9,12,15,18-21H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | RNRHZGNDJIHLCX-ZKWNWVNESA-N |
| XLogP | 5.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|