About 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine
5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine (PubChem CID 113384435) has the molecular formula C12H17N5S
and a molecular weight of 263.37 g/mol. Its IUPAC name is 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
| PubChem CID | 113384435 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1SCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C12H17N5S/c1-17-11(14)15-16-12(17)18-8-2-3-9-4-6-10(13)7-5-9/h4-7H,2-3,8,13H2,1H3,(H2,14,15) |
| InChIKey | OTYWQEDMZZHZBY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine (CID 113384435) is 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine is Cn1c(N)nnc1SCCCc1ccc(N)cc1.
What is the InChIKey of 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine?
The InChIKey is OTYWQEDMZZHZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5S/c1-17-11(14)15-16-12(17)18-8-2-3-9-4-6-10(13)7-5-9/h4-7H,2-3,8,13H2,1H3,(H2,14,15).
What are the key properties of 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine?
5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine has a molecular weight of 263.37 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-aminophenyl)propylsulfanyl]-4-methyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 113384435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).