About triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane
triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane (PubChem CID 11338455) has the molecular formula C22H44O2Si2
and a molecular weight of 396.76 g/mol. Its IUPAC name is triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane.
Molecular Properties
| Compound Name | triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane |
| PubChem CID | 11338455 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane |
| SMILES | C#CC[C@H](CC(=C)[C@@H](C)CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H44O2Si2/c1-10-17-22(24-26(14-5,15-6)16-7)18-20(8)21(9)19-23-25(11-2,12-3)13-4/h1,21-22H,8,11-19H2,2-7,9H3/t21-,22+/m0/s1 |
| InChIKey | BDVAHIOEZICWJQ-FCHUYYIVSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane?
The IUPAC name of triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane (CID 11338455) is triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane.
What is the SMILES notation for triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane?
The canonical SMILES for triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane is C#CC[C@H](CC(=C)[C@@H](C)CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane?
The InChIKey is BDVAHIOEZICWJQ-FCHUYYIVSA-N. The full InChI is InChI=1S/C22H44O2Si2/c1-10-17-22(24-26(14-5,15-6)16-7)18-20(8)21(9)19-23-25(11-2,12-3)13-4/h1,21-22H,8,11-19H2,2-7,9H3/t21-,22+/m0/s1.
What are the key properties of triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane?
triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane has a molecular weight of 396.76 g/mol, XLogP of 7.00, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(2R,5R)-2-methyl-3-methylidene-5-triethylsilyloxyoct-7-ynoxy]silane is sourced from PubChem (CID 11338455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).