About 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine
1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine (PubChem CID 113384763) has the molecular formula C16H25NS
and a molecular weight of 263.45 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine |
| PubChem CID | 113384763 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(SC2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C16H25NS/c1-12-8-13(2)10-16(9-12)18-15-6-4-14(5-7-15)11-17-3/h4-7,12-13,16-17H,8-11H2,1-3H3 |
| InChIKey | ANMCWPONJNOWAK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine?
The IUPAC name of 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine (CID 113384763) is 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine.
What is the SMILES notation for 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine?
The canonical SMILES for 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine is CNCc1ccc(SC2CC(C)CC(C)C2)cc1.
What is the InChIKey of 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine?
The InChIKey is ANMCWPONJNOWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NS/c1-12-8-13(2)10-16(9-12)18-15-6-4-14(5-7-15)11-17-3/h4-7,12-13,16-17H,8-11H2,1-3H3.
What are the key properties of 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine?
1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine has a molecular weight of 263.45 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3,5-dimethylcyclohexyl)sulfanylphenyl]-N-methylmethanamine is sourced from PubChem (CID 113384763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).