C17H22O9S — CID 11338601
methyl (3aR,5S,6R,6aS)-6-hydroxy-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-3a-carboxylate (PubChem CID 11338601) has the molecular formula C17H22O9S and a molecular weight of 402.42 g/mol. Its IUPAC name is methyl (3aR,5S,6R,6aS)-6-hydroxy-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-3a-carboxylate.
| Compound Name | methyl (3aR,5S,6R,6aS)-6-hydroxy-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-3a-carboxylate |
|---|---|
| PubChem CID | 11338601 |
| Molecular Formula | C17H22O9S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | methyl (3aR,5S,6R,6aS)-6-hydroxy-2,2-dimethyl-5-[(4-methylphenyl)sulfonyloxymethyl]-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@@H](COS(=O)(=O)c3ccc(C)cc3)[C@@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C17H22O9S/c1-10-5-7-11(8-6-10)27(20,21)23-9-12-13(18)14-17(24-12,15(19)22-4)26-16(2,3)25-14/h5-8,12-14,18H,9H2,1-4H3/t12-,13+,14-,17+/m0/s1 |
| InChIKey | YMERBCFZKNGJIB-QDEZUTFSSA-N |
| XLogP | 0.48 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|