About N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide
N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide (PubChem CID 11338645) has the molecular formula C19H22BrN3S
and a molecular weight of 404.38 g/mol. Its IUPAC name is N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide.
Molecular Properties
| Compound Name | N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| PubChem CID | 11338645 |
| Molecular Formula | C19H22BrN3S |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| SMILES | Br.CCCC/N=c1\nc(-c2ccccc2)n(-c2cccc(C)c2)s1 |
| InChI | InChI=1S/C19H21N3S.BrH/c1-3-4-13-20-19-21-18(16-10-6-5-7-11-16)22(23-19)17-12-8-9-15(2)14-17;/h5-12,14H,3-4,13H2,1-2H3;1H/b20-19+; |
| InChIKey | AGVKYIINPCGMJP-RZLHGTIFSA-N |
| XLogP | 5.19 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The IUPAC name of N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide (CID 11338645) is N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide.
What is the SMILES notation for N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The canonical SMILES for N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide is Br.CCCC/N=c1\nc(-c2ccccc2)n(-c2cccc(C)c2)s1.
What is the InChIKey of N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
The InChIKey is AGVKYIINPCGMJP-RZLHGTIFSA-N. The full InChI is InChI=1S/C19H21N3S.BrH/c1-3-4-13-20-19-21-18(16-10-6-5-7-11-16)22(23-19)17-12-8-9-15(2)14-17;/h5-12,14H,3-4,13H2,1-2H3;1H/b20-19+;.
What are the key properties of N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide?
N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide has a molecular weight of 404.38 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-(3-methylphenyl)-3-phenyl-1,2,4-thiadiazol-5-imine;hydrobromide is sourced from PubChem (CID 11338645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).