C11H13N3O4S — CID 113388410
(E)-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 113388410) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is (E)-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113388410 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (E)-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(N2CCS(=O)(=O)CC2)nc1 |
| InChI | InChI=1S/C11H13N3O4S/c15-10(16)2-1-9-7-12-11(13-8-9)14-3-5-19(17,18)6-4-14/h1-2,7-8H,3-6H2,(H,15,16)/b2-1+ |
| InChIKey | QGHWCAPOBVXDSX-OWOJBTEDSA-N |
| XLogP | -0.19 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|