C13H20N2O2 — CID 113388930
(1S)-1-(2-methoxy-6-morpholin-4-ylphenyl)ethanamine (PubChem CID 113388930) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S)-1-(2-methoxy-6-morpholin-4-ylphenyl)ethanamine.
| Compound Name | (1S)-1-(2-methoxy-6-morpholin-4-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 113388930 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (1S)-1-(2-methoxy-6-morpholin-4-ylphenyl)ethanamine |
| SMILES | COc1cccc(N2CCOCC2)c1[C@H](C)N |
| InChI | InChI=1S/C13H20N2O2/c1-10(14)13-11(4-3-5-12(13)16-2)15-6-8-17-9-7-15/h3-5,10H,6-9,14H2,1-2H3/t10-/m0/s1 |
| InChIKey | UNSWSJKCJGNANV-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |