C14H21NO3 — CID 113389072
1-[2-methoxy-6-(oxolan-2-ylmethoxy)phenyl]ethanamine (PubChem CID 113389072) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[2-methoxy-6-(oxolan-2-ylmethoxy)phenyl]ethanamine.
| Compound Name | 1-[2-methoxy-6-(oxolan-2-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 113389072 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[2-methoxy-6-(oxolan-2-ylmethoxy)phenyl]ethanamine |
| SMILES | COc1cccc(OCC2CCCO2)c1C(C)N |
| InChI | InChI=1S/C14H21NO3/c1-10(15)14-12(16-2)6-3-7-13(14)18-9-11-5-4-8-17-11/h3,6-7,10-11H,4-5,8-9,15H2,1-2H3 |
| InChIKey | SLDPWZOHNIYSJU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |