C23H27NO6 — CID 11338934
(5S,8R,9R)-8-benzyl-2-[(1E,3E)-hexa-1,3-dienyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 11338934) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (5S,8R,9R)-8-benzyl-2-[(1E,3E)-hexa-1,3-dienyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8R,9R)-8-benzyl-2-[(1E,3E)-hexa-1,3-dienyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 11338934 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (5S,8R,9R)-8-benzyl-2-[(1E,3E)-hexa-1,3-dienyl]-8-hydroxy-9-(methoxymethoxy)-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C/C=C/C1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](O)(Cc1ccccc1)[C@@H]2OCOC |
| InChI | InChI=1S/C23H27NO6/c1-4-5-6-10-13-18-16(2)19(25)23(30-18)20(29-15-28-3)22(27,24-21(23)26)14-17-11-8-7-9-12-17/h5-13,20,27H,4,14-15H2,1-3H3,(H,24,26)/b6-5+,13-10+/t20-,22+,23+/m0/s1 |
| InChIKey | ZXOWPLRVAVBFFJ-GKWWRKBKSA-N |
| XLogP | 2.17 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|