C13H20FNO2 — CID 113389409
4-amino-2-(2-fluoro-6-methoxyphenyl)-3,3-dimethylbutan-2-ol (PubChem CID 113389409) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-amino-2-(2-fluoro-6-methoxyphenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 4-amino-2-(2-fluoro-6-methoxyphenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 113389409 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-amino-2-(2-fluoro-6-methoxyphenyl)-3,3-dimethylbutan-2-ol |
| SMILES | COc1cccc(F)c1C(C)(O)C(C)(C)CN |
| InChI | InChI=1S/C13H20FNO2/c1-12(2,8-15)13(3,16)11-9(14)6-5-7-10(11)17-4/h5-7,16H,8,15H2,1-4H3 |
| InChIKey | CLHWTEJEMJYXER-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |